C16H20N2O2 — CID 102914953
ethyl 2-[7-[(cyclopropylamino)methyl]indol-1-yl]acetate (PubChem CID 102914953) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is ethyl 2-[7-[(cyclopropylamino)methyl]indol-1-yl]acetate.
| Compound Name | ethyl 2-[7-[(cyclopropylamino)methyl]indol-1-yl]acetate |
|---|---|
| PubChem CID | 102914953 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | ethyl 2-[7-[(cyclopropylamino)methyl]indol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1ccc2cccc(CNC3CC3)c21 |
| InChI | InChI=1S/C16H20N2O2/c1-2-20-15(19)11-18-9-8-12-4-3-5-13(16(12)18)10-17-14-6-7-14/h3-5,8-9,14,17H,2,6-7,10-11H2,1H3 |
| InChIKey | UACZXKRKNTYXNP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |