C18H33N3 — CID 102915337
6-methyl-N-(3-methyl-2-propan-2-ylbutyl)-4-(propylaminomethyl)pyridin-2-amine (PubChem CID 102915337) has the molecular formula C18H33N3 and a molecular weight of 291.48 g/mol. Its IUPAC name is 6-methyl-N-(3-methyl-2-propan-2-ylbutyl)-4-(propylaminomethyl)pyridin-2-amine.
| Compound Name | 6-methyl-N-(3-methyl-2-propan-2-ylbutyl)-4-(propylaminomethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102915337 |
| Molecular Formula | C18H33N3 |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.27 |
| IUPAC Name | 6-methyl-N-(3-methyl-2-propan-2-ylbutyl)-4-(propylaminomethyl)pyridin-2-amine |
| SMILES | CCCNCc1cc(C)nc(NCC(C(C)C)C(C)C)c1 |
| InChI | InChI=1S/C18H33N3/c1-7-8-19-11-16-9-15(6)21-18(10-16)20-12-17(13(2)3)14(4)5/h9-10,13-14,17,19H,7-8,11-12H2,1-6H3,(H,20,21) |
| InChIKey | YXWDAJCLYODBOI-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|