C12H16N2O — CID 102916522
2-[6-(methylaminomethyl)indol-1-yl]ethanol (PubChem CID 102916522) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-[6-(methylaminomethyl)indol-1-yl]ethanol.
| Compound Name | 2-[6-(methylaminomethyl)indol-1-yl]ethanol |
|---|---|
| PubChem CID | 102916522 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 2-[6-(methylaminomethyl)indol-1-yl]ethanol |
| SMILES | CNCc1ccc2ccn(CCO)c2c1 |
| InChI | InChI=1S/C12H16N2O/c1-13-9-10-2-3-11-4-5-14(6-7-15)12(11)8-10/h2-5,8,13,15H,6-7,9H2,1H3 |
| InChIKey | LVQOFBMSQPYHFC-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |