C16H27N5O4 — CID 10291655
(3R)-3-[3-[(carbamoylamino)methyl]-1,2,4-oxadiazol-5-yl]-6-cyclohexyl-N-hydroxyhexanamide (PubChem CID 10291655) has the molecular formula C16H27N5O4 and a molecular weight of 353.42 g/mol. Its IUPAC name is (3R)-3-[3-[(carbamoylamino)methyl]-1,2,4-oxadiazol-5-yl]-6-cyclohexyl-N-hydroxyhexanamide.
| Compound Name | (3R)-3-[3-[(carbamoylamino)methyl]-1,2,4-oxadiazol-5-yl]-6-cyclohexyl-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 10291655 |
| Molecular Formula | C16H27N5O4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | (3R)-3-[3-[(carbamoylamino)methyl]-1,2,4-oxadiazol-5-yl]-6-cyclohexyl-N-hydroxyhexanamide |
| SMILES | NC(=O)NCc1noc(C(CCCC2CCCCC2)CC(=O)NO)n1 |
| InChI | InChI=1S/C16H27N5O4/c17-16(23)18-10-13-19-15(25-21-13)12(9-14(22)20-24)8-4-7-11-5-2-1-3-6-11/h11-12,24H,1-10H2,(H,20,22)(H3,17,18,23) |
| InChIKey | HKJAZOFDJVASPW-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 143.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|