C15H18N4O — CID 102916807
N-[[1-(1,2,4-oxadiazol-3-ylmethyl)indol-6-yl]methyl]propan-1-amine (PubChem CID 102916807) has the molecular formula C15H18N4O and a molecular weight of 270.34 g/mol. Its IUPAC name is N-[[1-(1,2,4-oxadiazol-3-ylmethyl)indol-6-yl]methyl]propan-1-amine.
| Compound Name | N-[[1-(1,2,4-oxadiazol-3-ylmethyl)indol-6-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 102916807 |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | N-[[1-(1,2,4-oxadiazol-3-ylmethyl)indol-6-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccc2ccn(Cc3ncon3)c2c1 |
| InChI | InChI=1S/C15H18N4O/c1-2-6-16-9-12-3-4-13-5-7-19(14(13)8-12)10-15-17-11-20-18-15/h3-5,7-8,11,16H,2,6,9-10H2,1H3 |
| InChIKey | OYERVBWREZTQJJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 55.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|