C17H26N2 — CID 102917956
1-[1-(2-methylbutyl)indol-6-yl]butan-2-amine (PubChem CID 102917956) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 1-[1-(2-methylbutyl)indol-6-yl]butan-2-amine.
| Compound Name | 1-[1-(2-methylbutyl)indol-6-yl]butan-2-amine |
|---|---|
| PubChem CID | 102917956 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 1-[1-(2-methylbutyl)indol-6-yl]butan-2-amine |
| SMILES | CCC(C)Cn1ccc2ccc(CC(N)CC)cc21 |
| InChI | InChI=1S/C17H26N2/c1-4-13(3)12-19-9-8-15-7-6-14(11-17(15)19)10-16(18)5-2/h6-9,11,13,16H,4-5,10,12,18H2,1-3H3 |
| InChIKey | YNTYQCVPPKXRQR-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|