C9H8ClF3N4O — CID 102918218
5-chloro-7-(4,4,4-trifluorobutoxy)-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 102918218) has the molecular formula C9H8ClF3N4O and a molecular weight of 280.64 g/mol. Its IUPAC name is 5-chloro-7-(4,4,4-trifluorobutoxy)-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 5-chloro-7-(4,4,4-trifluorobutoxy)-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 102918218 |
| Molecular Formula | C9H8ClF3N4O |
| Molecular Weight | 280.64 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 5-chloro-7-(4,4,4-trifluorobutoxy)-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | FC(F)(F)CCCOc1cc(Cl)nc2ncnn12 |
| InChI | InChI=1S/C9H8ClF3N4O/c10-6-4-7(17-8(16-6)14-5-15-17)18-3-1-2-9(11,12)13/h4-5H,1-3H2 |
| InChIKey | UFWFJPZXGVYCBX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.64 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|