C15H17F6NO2 — CID 10291832
2-[4-[(Z)-N-ethoxy-C-propylcarbonimidoyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 10291832) has the molecular formula C15H17F6NO2 and a molecular weight of 357.29 g/mol. Its IUPAC name is 2-[4-[(Z)-N-ethoxy-C-propylcarbonimidoyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-[(Z)-N-ethoxy-C-propylcarbonimidoyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 10291832 |
| Molecular Formula | C15H17F6NO2 |
| Molecular Weight | 357.29 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 2-[4-[(Z)-N-ethoxy-C-propylcarbonimidoyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CCC/C(=N/OCC)c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H17F6NO2/c1-3-5-12(22-24-4-2)10-6-8-11(9-7-10)13(23,14(16,17)18)15(19,20)21/h6-9,23H,3-5H2,1-2H3/b22-12- |
| InChIKey | APPHWHRERVCLPW-UUYOSTAYSA-N |
| XLogP | 4.54 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.29 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|