C11H5ClF3N5 — CID 102918776
5-chloro-N-(3,4,5-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 102918776) has the molecular formula C11H5ClF3N5 and a molecular weight of 299.64 g/mol. Its IUPAC name is 5-chloro-N-(3,4,5-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-chloro-N-(3,4,5-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 102918776 |
| Molecular Formula | C11H5ClF3N5 |
| Molecular Weight | 299.64 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | 5-chloro-N-(3,4,5-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | Fc1cc(Nc2cc(Cl)nc3ncnn23)cc(F)c1F |
| InChI | InChI=1S/C11H5ClF3N5/c12-8-3-9(20-11(19-8)16-4-17-20)18-5-1-6(13)10(15)7(14)2-5/h1-4,18H |
| InChIKey | VLTOOCYXMCHMFF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.64 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|