About 4-(2,5-difluoroanilino)-6,7-dimethoxyquinoline-3-carboxamide
4-(2,5-difluoroanilino)-6,7-dimethoxyquinoline-3-carboxamide (PubChem CID 10291931) has the molecular formula C18H15F2N3O3
and a molecular weight of 359.33 g/mol. Its IUPAC name is 4-(2,5-difluoroanilino)-6,7-dimethoxyquinoline-3-carboxamide.
Molecular Properties
| Compound Name | 4-(2,5-difluoroanilino)-6,7-dimethoxyquinoline-3-carboxamide |
| PubChem CID | 10291931 |
| Molecular Formula | C18H15F2N3O3 |
| Molecular Weight | 359.33 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 4-(2,5-difluoroanilino)-6,7-dimethoxyquinoline-3-carboxamide |
| SMILES | COc1cc2ncc(C(N)=O)c(Nc3cc(F)ccc3F)c2cc1OC |
| InChI | InChI=1S/C18H15F2N3O3/c1-25-15-6-10-13(7-16(15)26-2)22-8-11(18(21)24)17(10)23-14-5-9(19)3-4-12(14)20/h3-8H,1-2H3,(H2,21,24)(H,22,23) |
| InChIKey | YMHNYVNOYXPQLO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.33 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(2,5-difluoroanilino)-6,7-dimethoxyquinoline-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,5-difluoroanilino)-6,7-dimethoxyquinoline-3-carboxamide?
The IUPAC name of 4-(2,5-difluoroanilino)-6,7-dimethoxyquinoline-3-carboxamide (CID 10291931) is 4-(2,5-difluoroanilino)-6,7-dimethoxyquinoline-3-carboxamide.
What is the SMILES notation for 4-(2,5-difluoroanilino)-6,7-dimethoxyquinoline-3-carboxamide?
The canonical SMILES for 4-(2,5-difluoroanilino)-6,7-dimethoxyquinoline-3-carboxamide is COc1cc2ncc(C(N)=O)c(Nc3cc(F)ccc3F)c2cc1OC.
What is the InChIKey of 4-(2,5-difluoroanilino)-6,7-dimethoxyquinoline-3-carboxamide?
The InChIKey is YMHNYVNOYXPQLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15F2N3O3/c1-25-15-6-10-13(7-16(15)26-2)22-8-11(18(21)24)17(10)23-14-5-9(19)3-4-12(14)20/h3-8H,1-2H3,(H2,21,24)(H,22,23).
What are the key properties of 4-(2,5-difluoroanilino)-6,7-dimethoxyquinoline-3-carboxamide?
4-(2,5-difluoroanilino)-6,7-dimethoxyquinoline-3-carboxamide has a molecular weight of 359.33 g/mol, XLogP of 3.37, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,5-difluoroanilino)-6,7-dimethoxyquinoline-3-carboxamide is sourced from PubChem (CID 10291931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).