About [2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylsulfonyl)-4-fluorophenyl]methanol
[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylsulfonyl)-4-fluorophenyl]methanol (PubChem CID 102919676) has the molecular formula C14H14FNO3S2
and a molecular weight of 327.40 g/mol. Its IUPAC name is [2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylsulfonyl)-4-fluorophenyl]methanol.
Molecular Properties
| Compound Name | [2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylsulfonyl)-4-fluorophenyl]methanol |
| PubChem CID | 102919676 |
| Molecular Formula | C14H14FNO3S2 |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | [2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylsulfonyl)-4-fluorophenyl]methanol |
| SMILES | O=S(=O)(c1cc(F)ccc1CO)N1CCc2sccc2C1 |
| InChI | InChI=1S/C14H14FNO3S2/c15-12-2-1-11(9-17)14(7-12)21(18,19)16-5-3-13-10(8-16)4-6-20-13/h1-2,4,6-7,17H,3,5,8-9H2 |
| InChIKey | JULKNCOZNSUOLV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylsulfonyl)-4-fluorophenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylsulfonyl)-4-fluorophenyl]methanol?
The IUPAC name of [2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylsulfonyl)-4-fluorophenyl]methanol (CID 102919676) is [2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylsulfonyl)-4-fluorophenyl]methanol.
What is the SMILES notation for [2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylsulfonyl)-4-fluorophenyl]methanol?
The canonical SMILES for [2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylsulfonyl)-4-fluorophenyl]methanol is O=S(=O)(c1cc(F)ccc1CO)N1CCc2sccc2C1.
What is the InChIKey of [2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylsulfonyl)-4-fluorophenyl]methanol?
The InChIKey is JULKNCOZNSUOLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14FNO3S2/c15-12-2-1-11(9-17)14(7-12)21(18,19)16-5-3-13-10(8-16)4-6-20-13/h1-2,4,6-7,17H,3,5,8-9H2.
What are the key properties of [2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylsulfonyl)-4-fluorophenyl]methanol?
[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylsulfonyl)-4-fluorophenyl]methanol has a molecular weight of 327.40 g/mol, XLogP of 2.13, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylsulfonyl)-4-fluorophenyl]methanol is sourced from PubChem (CID 102919676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).