C13H19FN2O2S — CID 102920994
5-fluoro-2-(methylaminomethyl)-N-[(2-methylcyclopropyl)methyl]benzenesulfonamide (PubChem CID 102920994) has the molecular formula C13H19FN2O2S and a molecular weight of 286.37 g/mol. Its IUPAC name is 5-fluoro-2-(methylaminomethyl)-N-[(2-methylcyclopropyl)methyl]benzenesulfonamide.
| Compound Name | 5-fluoro-2-(methylaminomethyl)-N-[(2-methylcyclopropyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 102920994 |
| Molecular Formula | C13H19FN2O2S |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 5-fluoro-2-(methylaminomethyl)-N-[(2-methylcyclopropyl)methyl]benzenesulfonamide |
| SMILES | CNCc1ccc(F)cc1S(=O)(=O)NCC1CC1C |
| InChI | InChI=1S/C13H19FN2O2S/c1-9-5-11(9)8-16-19(17,18)13-6-12(14)4-3-10(13)7-15-2/h3-4,6,9,11,15-16H,5,7-8H2,1-2H3 |
| InChIKey | JYHIRCHWVDSIEF-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |