C15H16N4O — CID 102921257
N-[(2-aminophenyl)methyl]-N-cyclopropylpyrimidine-5-carboxamide (PubChem CID 102921257) has the molecular formula C15H16N4O and a molecular weight of 268.32 g/mol. Its IUPAC name is N-[(2-aminophenyl)methyl]-N-cyclopropylpyrimidine-5-carboxamide.
| Compound Name | N-[(2-aminophenyl)methyl]-N-cyclopropylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 102921257 |
| Molecular Formula | C15H16N4O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | N-[(2-aminophenyl)methyl]-N-cyclopropylpyrimidine-5-carboxamide |
| SMILES | Nc1ccccc1CN(C(=O)c1cncnc1)C1CC1 |
| InChI | InChI=1S/C15H16N4O/c16-14-4-2-1-3-11(14)9-19(13-5-6-13)15(20)12-7-17-10-18-8-12/h1-4,7-8,10,13H,5-6,9,16H2 |
| InChIKey | OIPUDWPXCLKMPD-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|