C11H14N4OS — CID 102921864
1-(pyrimidine-5-carbonyl)piperidine-3-carbothioamide (PubChem CID 102921864) has the molecular formula C11H14N4OS and a molecular weight of 250.33 g/mol. Its IUPAC name is 1-(pyrimidine-5-carbonyl)piperidine-3-carbothioamide.
| Compound Name | 1-(pyrimidine-5-carbonyl)piperidine-3-carbothioamide |
|---|---|
| PubChem CID | 102921864 |
| Molecular Formula | C11H14N4OS |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 1-(pyrimidine-5-carbonyl)piperidine-3-carbothioamide |
| SMILES | NC(=S)C1CCCN(C(=O)c2cncnc2)C1 |
| InChI | InChI=1S/C11H14N4OS/c12-10(17)8-2-1-3-15(6-8)11(16)9-4-13-7-14-5-9/h4-5,7-8H,1-3,6H2,(H2,12,17) |
| InChIKey | YQQMGVGJNISQLD-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|