C10H15N3O2 — CID 102922170
N-(1-hydroxy-3-methylbutan-2-yl)pyrimidine-5-carboxamide (PubChem CID 102922170) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is N-(1-hydroxy-3-methylbutan-2-yl)pyrimidine-5-carboxamide.
| Compound Name | N-(1-hydroxy-3-methylbutan-2-yl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 102922170 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | N-(1-hydroxy-3-methylbutan-2-yl)pyrimidine-5-carboxamide |
| SMILES | CC(C)C(CO)NC(=O)c1cncnc1 |
| InChI | InChI=1S/C10H15N3O2/c1-7(2)9(5-14)13-10(15)8-3-11-6-12-4-8/h3-4,6-7,9,14H,5H2,1-2H3,(H,13,15) |
| InChIKey | WFJDCXZQCMDWMI-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |