About 4-cyclopentyl-N-(2-methyl-4-nitrophenyl)-4-azatricyclo[4.3.1.13,8]undecan-5-imine
4-cyclopentyl-N-(2-methyl-4-nitrophenyl)-4-azatricyclo[4.3.1.13,8]undecan-5-imine (PubChem CID 10292424) has the molecular formula C22H29N3O2
and a molecular weight of 367.49 g/mol. Its IUPAC name is 4-cyclopentyl-N-(2-methyl-4-nitrophenyl)-4-azatricyclo[4.3.1.13,8]undecan-5-imine.
Molecular Properties
| Compound Name | 4-cyclopentyl-N-(2-methyl-4-nitrophenyl)-4-azatricyclo[4.3.1.13,8]undecan-5-imine |
| PubChem CID | 10292424 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | 4-cyclopentyl-N-(2-methyl-4-nitrophenyl)-4-azatricyclo[4.3.1.13,8]undecan-5-imine |
| SMILES | Cc1cc([N+](=O)[O-])ccc1/N=C1\C2CC3CC(C2)CC(C3)N1C1CCCC1 |
| InChI | InChI=1S/C22H29N3O2/c1-14-8-19(25(26)27)6-7-21(14)23-22-17-10-15-9-16(11-17)13-20(12-15)24(22)18-4-2-3-5-18/h6-8,15-18,20H,2-5,9-13H2,1H3/b23-22+ |
| InChIKey | DYRSOQOJXBROQT-GHVJWSGMSA-N |
| XLogP | 5.39 |
| TPSA | 58.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclopentyl-N-(2-methyl-4-nitrophenyl)-4-azatricyclo[4.3.1.13,8]undecan-5-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopentyl-N-(2-methyl-4-nitrophenyl)-4-azatricyclo[4.3.1.13,8]undecan-5-imine?
The IUPAC name of 4-cyclopentyl-N-(2-methyl-4-nitrophenyl)-4-azatricyclo[4.3.1.13,8]undecan-5-imine (CID 10292424) is 4-cyclopentyl-N-(2-methyl-4-nitrophenyl)-4-azatricyclo[4.3.1.13,8]undecan-5-imine.
What is the SMILES notation for 4-cyclopentyl-N-(2-methyl-4-nitrophenyl)-4-azatricyclo[4.3.1.13,8]undecan-5-imine?
The canonical SMILES for 4-cyclopentyl-N-(2-methyl-4-nitrophenyl)-4-azatricyclo[4.3.1.13,8]undecan-5-imine is Cc1cc([N+](=O)[O-])ccc1/N=C1\C2CC3CC(C2)CC(C3)N1C1CCCC1.
What is the InChIKey of 4-cyclopentyl-N-(2-methyl-4-nitrophenyl)-4-azatricyclo[4.3.1.13,8]undecan-5-imine?
The InChIKey is DYRSOQOJXBROQT-GHVJWSGMSA-N. The full InChI is InChI=1S/C22H29N3O2/c1-14-8-19(25(26)27)6-7-21(14)23-22-17-10-15-9-16(11-17)13-20(12-15)24(22)18-4-2-3-5-18/h6-8,15-18,20H,2-5,9-13H2,1H3/b23-22+.
What are the key properties of 4-cyclopentyl-N-(2-methyl-4-nitrophenyl)-4-azatricyclo[4.3.1.13,8]undecan-5-imine?
4-cyclopentyl-N-(2-methyl-4-nitrophenyl)-4-azatricyclo[4.3.1.13,8]undecan-5-imine has a molecular weight of 367.49 g/mol, XLogP of 5.39, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopentyl-N-(2-methyl-4-nitrophenyl)-4-azatricyclo[4.3.1.13,8]undecan-5-imine is sourced from PubChem (CID 10292424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).