About 5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]isoquinolin-8-amine
5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]isoquinolin-8-amine (PubChem CID 102924675) has the molecular formula C16H15N3S
and a molecular weight of 281.38 g/mol. Its IUPAC name is 5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]isoquinolin-8-amine.
Molecular Properties
| Compound Name | 5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]isoquinolin-8-amine |
| PubChem CID | 102924675 |
| Molecular Formula | C16H15N3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]isoquinolin-8-amine |
| SMILES | Cc1cc(C)nc(Sc2ccc(N)c3cnccc23)c1 |
| InChI | InChI=1S/C16H15N3S/c1-10-7-11(2)19-16(8-10)20-15-4-3-14(17)13-9-18-6-5-12(13)15/h3-9H,17H2,1-2H3 |
| InChIKey | ZSDXVZKJVGNESP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]isoquinolin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]isoquinolin-8-amine?
The IUPAC name of 5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]isoquinolin-8-amine (CID 102924675) is 5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]isoquinolin-8-amine.
What is the SMILES notation for 5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]isoquinolin-8-amine?
The canonical SMILES for 5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]isoquinolin-8-amine is Cc1cc(C)nc(Sc2ccc(N)c3cnccc23)c1.
What is the InChIKey of 5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]isoquinolin-8-amine?
The InChIKey is ZSDXVZKJVGNESP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3S/c1-10-7-11(2)19-16(8-10)20-15-4-3-14(17)13-9-18-6-5-12(13)15/h3-9H,17H2,1-2H3.
What are the key properties of 5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]isoquinolin-8-amine?
5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]isoquinolin-8-amine has a molecular weight of 281.38 g/mol, XLogP of 3.98, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]isoquinolin-8-amine is sourced from PubChem (CID 102924675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).