C20H28N6O — CID 10292487
(2R,3S)-3-[[6-(benzylamino)-9-propan-2-ylpurin-2-yl]amino]pentan-2-ol (PubChem CID 10292487) has the molecular formula C20H28N6O and a molecular weight of 368.49 g/mol. Its IUPAC name is (2R,3S)-3-[[6-(benzylamino)-9-propan-2-ylpurin-2-yl]amino]pentan-2-ol.
| Compound Name | (2R,3S)-3-[[6-(benzylamino)-9-propan-2-ylpurin-2-yl]amino]pentan-2-ol |
|---|---|
| PubChem CID | 10292487 |
| Molecular Formula | C20H28N6O |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | (2R,3S)-3-[[6-(benzylamino)-9-propan-2-ylpurin-2-yl]amino]pentan-2-ol |
| SMILES | CC[C@H](Nc1nc(NCc2ccccc2)c2ncn(C(C)C)c2n1)[C@@H](C)O |
| InChI | InChI=1S/C20H28N6O/c1-5-16(14(4)27)23-20-24-18(21-11-15-9-7-6-8-10-15)17-19(25-20)26(12-22-17)13(2)3/h6-10,12-14,16,27H,5,11H2,1-4H3,(H2,21,23,24,25)/t14-,16+/m1/s1 |
| InChIKey | CVIBDXQYFNZNMA-ZBFHGGJFSA-N |
| XLogP | 3.59 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |