About 3-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]-4-methoxybenzonitrile
3-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]-4-methoxybenzonitrile (PubChem CID 102924913) has the molecular formula C16H16N2OS
and a molecular weight of 284.38 g/mol. Its IUPAC name is 3-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]-4-methoxybenzonitrile.
Molecular Properties
| Compound Name | 3-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]-4-methoxybenzonitrile |
| PubChem CID | 102924913 |
| Molecular Formula | C16H16N2OS |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 3-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]-4-methoxybenzonitrile |
| SMILES | COc1ccc(C#N)cc1CSc1cc(C)cc(C)n1 |
| InChI | InChI=1S/C16H16N2OS/c1-11-6-12(2)18-16(7-11)20-10-14-8-13(9-17)4-5-15(14)19-3/h4-8H,10H2,1-3H3 |
| InChIKey | VGGOIQVOTZEQPY-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]-4-methoxybenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]-4-methoxybenzonitrile?
The IUPAC name of 3-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]-4-methoxybenzonitrile (CID 102924913) is 3-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]-4-methoxybenzonitrile.
What is the SMILES notation for 3-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]-4-methoxybenzonitrile?
The canonical SMILES for 3-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]-4-methoxybenzonitrile is COc1ccc(C#N)cc1CSc1cc(C)cc(C)n1.
What is the InChIKey of 3-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]-4-methoxybenzonitrile?
The InChIKey is VGGOIQVOTZEQPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2OS/c1-11-6-12(2)18-16(7-11)20-10-14-8-13(9-17)4-5-15(14)19-3/h4-8H,10H2,1-3H3.
What are the key properties of 3-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]-4-methoxybenzonitrile?
3-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]-4-methoxybenzonitrile has a molecular weight of 284.38 g/mol, XLogP of 3.87, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]-4-methoxybenzonitrile is sourced from PubChem (CID 102924913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).