About [3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]pyrazin-2-yl]methanamine
[3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]pyrazin-2-yl]methanamine (PubChem CID 102925265) has the molecular formula C12H14N4S
and a molecular weight of 246.34 g/mol. Its IUPAC name is [3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]pyrazin-2-yl]methanamine.
Molecular Properties
| Compound Name | [3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]pyrazin-2-yl]methanamine |
| PubChem CID | 102925265 |
| Molecular Formula | C12H14N4S |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | [3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]pyrazin-2-yl]methanamine |
| SMILES | Cc1cc(C)nc(Sc2nccnc2CN)c1 |
| InChI | InChI=1S/C12H14N4S/c1-8-5-9(2)16-11(6-8)17-12-10(7-13)14-3-4-15-12/h3-6H,7,13H2,1-2H3 |
| InChIKey | WIUSNHIZZQJYDQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]pyrazin-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]pyrazin-2-yl]methanamine?
The IUPAC name of [3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]pyrazin-2-yl]methanamine (CID 102925265) is [3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]pyrazin-2-yl]methanamine.
What is the SMILES notation for [3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]pyrazin-2-yl]methanamine?
The canonical SMILES for [3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]pyrazin-2-yl]methanamine is Cc1cc(C)nc(Sc2nccnc2CN)c1.
What is the InChIKey of [3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]pyrazin-2-yl]methanamine?
The InChIKey is WIUSNHIZZQJYDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4S/c1-8-5-9(2)16-11(6-8)17-12-10(7-13)14-3-4-15-12/h3-6H,7,13H2,1-2H3.
What are the key properties of [3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]pyrazin-2-yl]methanamine?
[3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]pyrazin-2-yl]methanamine has a molecular weight of 246.34 g/mol, XLogP of 2.10, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]pyrazin-2-yl]methanamine is sourced from PubChem (CID 102925265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).