About 3-[3-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]phenyl]prop-2-yn-1-ol
3-[3-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]phenyl]prop-2-yn-1-ol (PubChem CID 102925568) has the molecular formula C17H17NOS
and a molecular weight of 283.40 g/mol. Its IUPAC name is 3-[3-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]phenyl]prop-2-yn-1-ol.
Molecular Properties
| Compound Name | 3-[3-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]phenyl]prop-2-yn-1-ol |
| PubChem CID | 102925568 |
| Molecular Formula | C17H17NOS |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 3-[3-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]phenyl]prop-2-yn-1-ol |
| SMILES | Cc1cc(C)nc(SCc2cccc(C#CCO)c2)c1 |
| InChI | InChI=1S/C17H17NOS/c1-13-9-14(2)18-17(10-13)20-12-16-6-3-5-15(11-16)7-4-8-19/h3,5-6,9-11,19H,8,12H2,1-2H3 |
| InChIKey | XXNAPSUFILNOQJ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]phenyl]prop-2-yn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]phenyl]prop-2-yn-1-ol?
The IUPAC name of 3-[3-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]phenyl]prop-2-yn-1-ol (CID 102925568) is 3-[3-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]phenyl]prop-2-yn-1-ol.
What is the SMILES notation for 3-[3-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]phenyl]prop-2-yn-1-ol?
The canonical SMILES for 3-[3-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]phenyl]prop-2-yn-1-ol is Cc1cc(C)nc(SCc2cccc(C#CCO)c2)c1.
What is the InChIKey of 3-[3-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]phenyl]prop-2-yn-1-ol?
The InChIKey is XXNAPSUFILNOQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NOS/c1-13-9-14(2)18-17(10-13)20-12-16-6-3-5-15(11-16)7-4-8-19/h3,5-6,9-11,19H,8,12H2,1-2H3.
What are the key properties of 3-[3-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]phenyl]prop-2-yn-1-ol?
3-[3-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]phenyl]prop-2-yn-1-ol has a molecular weight of 283.40 g/mol, XLogP of 3.33, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]phenyl]prop-2-yn-1-ol is sourced from PubChem (CID 102925568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).