About 3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-1-(methylamino)cyclohexane-1-carboxamide
3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-1-(methylamino)cyclohexane-1-carboxamide (PubChem CID 102925709) has the molecular formula C15H23N3OS
and a molecular weight of 293.44 g/mol. Its IUPAC name is 3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-1-(methylamino)cyclohexane-1-carboxamide.
Molecular Properties
| Compound Name | 3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-1-(methylamino)cyclohexane-1-carboxamide |
| PubChem CID | 102925709 |
| Molecular Formula | C15H23N3OS |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-1-(methylamino)cyclohexane-1-carboxamide |
| SMILES | CNC1(C(N)=O)CCCC(Sc2cc(C)cc(C)n2)C1 |
| InChI | InChI=1S/C15H23N3OS/c1-10-7-11(2)18-13(8-10)20-12-5-4-6-15(9-12,17-3)14(16)19/h7-8,12,17H,4-6,9H2,1-3H3,(H2,16,19) |
| InChIKey | SHVAZUYEJPANAG-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-1-(methylamino)cyclohexane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-1-(methylamino)cyclohexane-1-carboxamide?
The IUPAC name of 3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-1-(methylamino)cyclohexane-1-carboxamide (CID 102925709) is 3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-1-(methylamino)cyclohexane-1-carboxamide.
What is the SMILES notation for 3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-1-(methylamino)cyclohexane-1-carboxamide?
The canonical SMILES for 3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-1-(methylamino)cyclohexane-1-carboxamide is CNC1(C(N)=O)CCCC(Sc2cc(C)cc(C)n2)C1.
What is the InChIKey of 3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-1-(methylamino)cyclohexane-1-carboxamide?
The InChIKey is SHVAZUYEJPANAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3OS/c1-10-7-11(2)18-13(8-10)20-12-5-4-6-15(9-12,17-3)14(16)19/h7-8,12,17H,4-6,9H2,1-3H3,(H2,16,19).
What are the key properties of 3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-1-(methylamino)cyclohexane-1-carboxamide?
3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-1-(methylamino)cyclohexane-1-carboxamide has a molecular weight of 293.44 g/mol, XLogP of 2.18, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-1-(methylamino)cyclohexane-1-carboxamide is sourced from PubChem (CID 102925709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).