C10H13N5S2 — CID 102925881
[5-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]-1,3,4-thiadiazol-2-yl]hydrazine (PubChem CID 102925881) has the molecular formula C10H13N5S2 and a molecular weight of 267.38 g/mol. Its IUPAC name is [5-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]-1,3,4-thiadiazol-2-yl]hydrazine.
| Compound Name | [5-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]-1,3,4-thiadiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 102925881 |
| Molecular Formula | C10H13N5S2 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | [5-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]-1,3,4-thiadiazol-2-yl]hydrazine |
| SMILES | Cc1cc(C)nc(SCc2nnc(NN)s2)c1 |
| InChI | InChI=1S/C10H13N5S2/c1-6-3-7(2)12-8(4-6)16-5-9-14-15-10(13-11)17-9/h3-4H,5,11H2,1-2H3,(H,13,15) |
| InChIKey | PEYOBLFEYSTAKJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|