C16H20N2S — CID 102925922
N-benzyl-2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]ethanamine (PubChem CID 102925922) has the molecular formula C16H20N2S and a molecular weight of 272.42 g/mol. Its IUPAC name is N-benzyl-2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]ethanamine.
| Compound Name | N-benzyl-2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]ethanamine |
|---|---|
| PubChem CID | 102925922 |
| Molecular Formula | C16H20N2S |
| Molecular Weight | 272.42 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | N-benzyl-2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]ethanamine |
| SMILES | Cc1cc(C)nc(SCCNCc2ccccc2)c1 |
| InChI | InChI=1S/C16H20N2S/c1-13-10-14(2)18-16(11-13)19-9-8-17-12-15-6-4-3-5-7-15/h3-7,10-11,17H,8-9,12H2,1-2H3 |
| InChIKey | QRQHLFFLQLMQMX-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|