About (1S)-1-[2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-5-fluoro-4-methylphenyl]ethanol
(1S)-1-[2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-5-fluoro-4-methylphenyl]ethanol (PubChem CID 102926203) has the molecular formula C16H18FNOS
and a molecular weight of 291.39 g/mol. Its IUPAC name is (1S)-1-[2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-5-fluoro-4-methylphenyl]ethanol.
Molecular Properties
| Compound Name | (1S)-1-[2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-5-fluoro-4-methylphenyl]ethanol |
| PubChem CID | 102926203 |
| Molecular Formula | C16H18FNOS |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | (1S)-1-[2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-5-fluoro-4-methylphenyl]ethanol |
| SMILES | Cc1cc(C)nc(Sc2cc(C)c(F)cc2[C@H](C)O)c1 |
| InChI | InChI=1S/C16H18FNOS/c1-9-5-11(3)18-16(6-9)20-15-7-10(2)14(17)8-13(15)12(4)19/h5-8,12,19H,1-4H3/t12-/m0/s1 |
| InChIKey | SKXUMDNOCIQCJZ-LBPRGKRZSA-N |
| XLogP | 4.35 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1S)-1-[2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-5-fluoro-4-methylphenyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-[2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-5-fluoro-4-methylphenyl]ethanol?
The IUPAC name of (1S)-1-[2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-5-fluoro-4-methylphenyl]ethanol (CID 102926203) is (1S)-1-[2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-5-fluoro-4-methylphenyl]ethanol.
What is the SMILES notation for (1S)-1-[2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-5-fluoro-4-methylphenyl]ethanol?
The canonical SMILES for (1S)-1-[2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-5-fluoro-4-methylphenyl]ethanol is Cc1cc(C)nc(Sc2cc(C)c(F)cc2[C@H](C)O)c1.
What is the InChIKey of (1S)-1-[2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-5-fluoro-4-methylphenyl]ethanol?
The InChIKey is SKXUMDNOCIQCJZ-LBPRGKRZSA-N. The full InChI is InChI=1S/C16H18FNOS/c1-9-5-11(3)18-16(6-9)20-15-7-10(2)14(17)8-13(15)12(4)19/h5-8,12,19H,1-4H3/t12-/m0/s1.
What are the key properties of (1S)-1-[2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-5-fluoro-4-methylphenyl]ethanol?
(1S)-1-[2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-5-fluoro-4-methylphenyl]ethanol has a molecular weight of 291.39 g/mol, XLogP of 4.35, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-[2-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-5-fluoro-4-methylphenyl]ethanol is sourced from PubChem (CID 102926203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).