C12H18N4O3S — CID 102926552
4-[3-[2-(2-methoxyethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-N,3-dimethyl-1,2-thiazol-5-amine (PubChem CID 102926552) has the molecular formula C12H18N4O3S and a molecular weight of 298.37 g/mol. Its IUPAC name is 4-[3-[2-(2-methoxyethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-N,3-dimethyl-1,2-thiazol-5-amine.
| Compound Name | 4-[3-[2-(2-methoxyethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-N,3-dimethyl-1,2-thiazol-5-amine |
|---|---|
| PubChem CID | 102926552 |
| Molecular Formula | C12H18N4O3S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 4-[3-[2-(2-methoxyethoxy)ethyl]-1,2,4-oxadiazol-5-yl]-N,3-dimethyl-1,2-thiazol-5-amine |
| SMILES | CNc1snc(C)c1-c1nc(CCOCCOC)no1 |
| InChI | InChI=1S/C12H18N4O3S/c1-8-10(12(13-2)20-16-8)11-14-9(15-19-11)4-5-18-7-6-17-3/h13H,4-7H2,1-3H3 |
| InChIKey | QKLGOAIEJSTOLW-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 82.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|