About 6-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-7H-purin-2-amine
6-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-7H-purin-2-amine (PubChem CID 102927037) has the molecular formula C12H12N6S
and a molecular weight of 272.34 g/mol. Its IUPAC name is 6-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-7H-purin-2-amine.
Molecular Properties
| Compound Name | 6-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-7H-purin-2-amine |
| PubChem CID | 102927037 |
| Molecular Formula | C12H12N6S |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 6-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-7H-purin-2-amine |
| SMILES | Cc1cc(C)nc(Sc2nc(N)nc3nc[nH]c23)c1 |
| InChI | InChI=1S/C12H12N6S/c1-6-3-7(2)16-8(4-6)19-11-9-10(15-5-14-9)17-12(13)18-11/h3-5H,1-2H3,(H3,13,14,15,17,18) |
| InChIKey | LFPGMAQCWZMXCO-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-7H-purin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-7H-purin-2-amine?
The IUPAC name of 6-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-7H-purin-2-amine (CID 102927037) is 6-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-7H-purin-2-amine.
What is the SMILES notation for 6-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-7H-purin-2-amine?
The canonical SMILES for 6-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-7H-purin-2-amine is Cc1cc(C)nc(Sc2nc(N)nc3nc[nH]c23)c1.
What is the InChIKey of 6-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-7H-purin-2-amine?
The InChIKey is LFPGMAQCWZMXCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N6S/c1-6-3-7(2)16-8(4-6)19-11-9-10(15-5-14-9)17-12(13)18-11/h3-5H,1-2H3,(H3,13,14,15,17,18).
What are the key properties of 6-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-7H-purin-2-amine?
6-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-7H-purin-2-amine has a molecular weight of 272.34 g/mol, XLogP of 2.10, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-7H-purin-2-amine is sourced from PubChem (CID 102927037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).