C10H16N2O4 — CID 102927164
4-hydroxy-2-[2-(2-methoxyethoxy)ethyl]-5-methyl-1H-pyrimidin-6-one (PubChem CID 102927164) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is 4-hydroxy-2-[2-(2-methoxyethoxy)ethyl]-5-methyl-1H-pyrimidin-6-one.
| Compound Name | 4-hydroxy-2-[2-(2-methoxyethoxy)ethyl]-5-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 102927164 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 4-hydroxy-2-[2-(2-methoxyethoxy)ethyl]-5-methyl-1H-pyrimidin-6-one |
| SMILES | COCCOCCc1nc(O)c(C)c(=O)[nH]1 |
| InChI | InChI=1S/C10H16N2O4/c1-7-9(13)11-8(12-10(7)14)3-4-16-6-5-15-2/h3-6H2,1-2H3,(H2,11,12,13,14) |
| InChIKey | PVCDDFVWEBRHFN-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|