C11H21NO3 — CID 102927958
1-(3,4-dihydro-2H-pyran-5-yl)-3-(2-methoxyethoxy)propan-1-amine (PubChem CID 102927958) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-pyran-5-yl)-3-(2-methoxyethoxy)propan-1-amine.
| Compound Name | 1-(3,4-dihydro-2H-pyran-5-yl)-3-(2-methoxyethoxy)propan-1-amine |
|---|---|
| PubChem CID | 102927958 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | 1-(3,4-dihydro-2H-pyran-5-yl)-3-(2-methoxyethoxy)propan-1-amine |
| SMILES | COCCOCCC(N)C1=COCCC1 |
| InChI | InChI=1S/C11H21NO3/c1-13-7-8-14-6-4-11(12)10-3-2-5-15-9-10/h9,11H,2-8,12H2,1H3 |
| InChIKey | HTHIZAOPYKEDQR-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|