C17H28N2O2 — CID 102928601
1-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)-3-(2-methoxyethoxy)-N-propylpropan-1-amine (PubChem CID 102928601) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is 1-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)-3-(2-methoxyethoxy)-N-propylpropan-1-amine.
| Compound Name | 1-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)-3-(2-methoxyethoxy)-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 102928601 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 1-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)-3-(2-methoxyethoxy)-N-propylpropan-1-amine |
| SMILES | CCCNC(CCOCCOC)C1CCc2cccnc21 |
| InChI | InChI=1S/C17H28N2O2/c1-3-9-18-16(8-11-21-13-12-20-2)15-7-6-14-5-4-10-19-17(14)15/h4-5,10,15-16,18H,3,6-9,11-13H2,1-2H3 |
| InChIKey | SQSLDDHTLSNDQT-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|