C12H13IN2O2S — CID 10292899
6,7-dimethoxy-4H-indeno[1,2-d][1,3]thiazol-2-amine;hydroiodide (PubChem CID 10292899) has the molecular formula C12H13IN2O2S and a molecular weight of 376.22 g/mol. Its IUPAC name is 6,7-dimethoxy-4H-indeno[1,2-d][1,3]thiazol-2-amine;hydroiodide.
| Compound Name | 6,7-dimethoxy-4H-indeno[1,2-d][1,3]thiazol-2-amine;hydroiodide |
|---|---|
| PubChem CID | 10292899 |
| Molecular Formula | C12H13IN2O2S |
| Molecular Weight | 376.22 g/mol |
| Exact Mass | 375.97 |
| IUPAC Name | 6,7-dimethoxy-4H-indeno[1,2-d][1,3]thiazol-2-amine;hydroiodide |
| SMILES | COc1cc2c(cc1OC)-c1nc(N)sc1C2.I |
| InChI | InChI=1S/C12H12N2O2S.HI/c1-15-8-3-6-4-10-11(14-12(13)17-10)7(6)5-9(8)16-2;/h3,5H,4H2,1-2H3,(H2,13,14);1H |
| InChIKey | WIUKUZIKTRGASW-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.22 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|