About [1-(2,3-dihydrofuran-5-yl)-3-(2-methoxyethoxy)propyl]hydrazine
[1-(2,3-dihydrofuran-5-yl)-3-(2-methoxyethoxy)propyl]hydrazine (PubChem CID 102930061) has the molecular formula C10H20N2O3
and a molecular weight of 216.28 g/mol. Its IUPAC name is [1-(2,3-dihydrofuran-5-yl)-3-(2-methoxyethoxy)propyl]hydrazine.
Molecular Properties
| Compound Name | [1-(2,3-dihydrofuran-5-yl)-3-(2-methoxyethoxy)propyl]hydrazine |
| PubChem CID | 102930061 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | [1-(2,3-dihydrofuran-5-yl)-3-(2-methoxyethoxy)propyl]hydrazine |
| SMILES | COCCOCCC(NN)C1=CCCO1 |
| InChI | InChI=1S/C10H20N2O3/c1-13-7-8-14-6-4-9(12-11)10-3-2-5-15-10/h3,9,12H,2,4-8,11H2,1H3 |
| InChIKey | TZZVJOUKBKROJQ-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [1-(2,3-dihydrofuran-5-yl)-3-(2-methoxyethoxy)propyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,3-dihydrofuran-5-yl)-3-(2-methoxyethoxy)propyl]hydrazine?
The IUPAC name of [1-(2,3-dihydrofuran-5-yl)-3-(2-methoxyethoxy)propyl]hydrazine (CID 102930061) is [1-(2,3-dihydrofuran-5-yl)-3-(2-methoxyethoxy)propyl]hydrazine.
What is the SMILES notation for [1-(2,3-dihydrofuran-5-yl)-3-(2-methoxyethoxy)propyl]hydrazine?
The canonical SMILES for [1-(2,3-dihydrofuran-5-yl)-3-(2-methoxyethoxy)propyl]hydrazine is COCCOCCC(NN)C1=CCCO1.
What is the InChIKey of [1-(2,3-dihydrofuran-5-yl)-3-(2-methoxyethoxy)propyl]hydrazine?
The InChIKey is TZZVJOUKBKROJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O3/c1-13-7-8-14-6-4-9(12-11)10-3-2-5-15-10/h3,9,12H,2,4-8,11H2,1H3.
What are the key properties of [1-(2,3-dihydrofuran-5-yl)-3-(2-methoxyethoxy)propyl]hydrazine?
[1-(2,3-dihydrofuran-5-yl)-3-(2-methoxyethoxy)propyl]hydrazine has a molecular weight of 216.28 g/mol, XLogP of 0.18, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,3-dihydrofuran-5-yl)-3-(2-methoxyethoxy)propyl]hydrazine is sourced from PubChem (CID 102930061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).