C20H17N3O5 — CID 10293083
2-[5-benzamido-2-(4-methoxyphenyl)-6-oxopyrimidin-1-yl]acetic acid (PubChem CID 10293083) has the molecular formula C20H17N3O5 and a molecular weight of 379.37 g/mol. Its IUPAC name is 2-[5-benzamido-2-(4-methoxyphenyl)-6-oxopyrimidin-1-yl]acetic acid.
| Compound Name | 2-[5-benzamido-2-(4-methoxyphenyl)-6-oxopyrimidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 10293083 |
| Molecular Formula | C20H17N3O5 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 2-[5-benzamido-2-(4-methoxyphenyl)-6-oxopyrimidin-1-yl]acetic acid |
| SMILES | COc1ccc(-c2ncc(NC(=O)c3ccccc3)c(=O)n2CC(=O)O)cc1 |
| InChI | InChI=1S/C20H17N3O5/c1-28-15-9-7-13(8-10-15)18-21-11-16(20(27)23(18)12-17(24)25)22-19(26)14-5-3-2-4-6-14/h2-11H,12H2,1H3,(H,22,26)(H,24,25) |
| InChIKey | FVNWDOQIXHHZJC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |