C10H14N2O5S — CID 102930878
4-amino-2-[2-hydroxyethyl(methyl)sulfamoyl]benzoic acid (PubChem CID 102930878) has the molecular formula C10H14N2O5S and a molecular weight of 274.30 g/mol. Its IUPAC name is 4-amino-2-[2-hydroxyethyl(methyl)sulfamoyl]benzoic acid.
| Compound Name | 4-amino-2-[2-hydroxyethyl(methyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 102930878 |
| Molecular Formula | C10H14N2O5S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 4-amino-2-[2-hydroxyethyl(methyl)sulfamoyl]benzoic acid |
| SMILES | CN(CCO)S(=O)(=O)c1cc(N)ccc1C(=O)O |
| InChI | InChI=1S/C10H14N2O5S/c1-12(4-5-13)18(16,17)9-6-7(11)2-3-8(9)10(14)15/h2-3,6,13H,4-5,11H2,1H3,(H,14,15) |
| InChIKey | VSQWIFVUJZKAJN-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|