C12H20N4O3 — CID 102931530
(4-amino-5-ethyl-1H-pyrazol-3-yl)-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]methanone (PubChem CID 102931530) has the molecular formula C12H20N4O3 and a molecular weight of 268.32 g/mol. Its IUPAC name is (4-amino-5-ethyl-1H-pyrazol-3-yl)-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]methanone.
| Compound Name | (4-amino-5-ethyl-1H-pyrazol-3-yl)-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 102931530 |
| Molecular Formula | C12H20N4O3 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | (4-amino-5-ethyl-1H-pyrazol-3-yl)-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]methanone |
| SMILES | CCc1[nH]nc(C(=O)N2CC(C)OC(CO)C2)c1N |
| InChI | InChI=1S/C12H20N4O3/c1-3-9-10(13)11(15-14-9)12(18)16-4-7(2)19-8(5-16)6-17/h7-8,17H,3-6,13H2,1-2H3,(H,14,15) |
| InChIKey | ZTWRBDVVHFHJFS-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 104.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |