C19H16N4O3S — CID 10293154
2-[1-[(3-methyl-1,2-oxazol-5-yl)methyl]indol-3-yl]-N-(3-methyl-1,2-thiazol-5-yl)-2-oxoacetamide (PubChem CID 10293154) has the molecular formula C19H16N4O3S and a molecular weight of 380.43 g/mol. Its IUPAC name is 2-[1-[(3-methyl-1,2-oxazol-5-yl)methyl]indol-3-yl]-N-(3-methyl-1,2-thiazol-5-yl)-2-oxoacetamide.
| Compound Name | 2-[1-[(3-methyl-1,2-oxazol-5-yl)methyl]indol-3-yl]-N-(3-methyl-1,2-thiazol-5-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 10293154 |
| Molecular Formula | C19H16N4O3S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 2-[1-[(3-methyl-1,2-oxazol-5-yl)methyl]indol-3-yl]-N-(3-methyl-1,2-thiazol-5-yl)-2-oxoacetamide |
| SMILES | Cc1cc(Cn2cc(C(=O)C(=O)Nc3cc(C)ns3)c3ccccc32)on1 |
| InChI | InChI=1S/C19H16N4O3S/c1-11-7-13(26-21-11)9-23-10-15(14-5-3-4-6-16(14)23)18(24)19(25)20-17-8-12(2)22-27-17/h3-8,10H,9H2,1-2H3,(H,20,25) |
| InChIKey | NCACNRXZERQYMR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 90.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|