C16H25BrN2O2 — CID 102932098
[4-[2-amino-1-(4-bromophenyl)butyl]-6-methylmorpholin-2-yl]methanol (PubChem CID 102932098) has the molecular formula C16H25BrN2O2 and a molecular weight of 357.29 g/mol. Its IUPAC name is [4-[2-amino-1-(4-bromophenyl)butyl]-6-methylmorpholin-2-yl]methanol.
| Compound Name | [4-[2-amino-1-(4-bromophenyl)butyl]-6-methylmorpholin-2-yl]methanol |
|---|---|
| PubChem CID | 102932098 |
| Molecular Formula | C16H25BrN2O2 |
| Molecular Weight | 357.29 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | [4-[2-amino-1-(4-bromophenyl)butyl]-6-methylmorpholin-2-yl]methanol |
| SMILES | CCC(N)C(c1ccc(Br)cc1)N1CC(C)OC(CO)C1 |
| InChI | InChI=1S/C16H25BrN2O2/c1-3-15(18)16(12-4-6-13(17)7-5-12)19-8-11(2)21-14(9-19)10-20/h4-7,11,14-16,20H,3,8-10,18H2,1-2H3 |
| InChIKey | VWKYKKQTLQRPMS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |