C14H21NO5 — CID 102932297
6-[2-(hydroxymethyl)-6-methylmorpholine-4-carbonyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 102932297) has the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. Its IUPAC name is 6-[2-(hydroxymethyl)-6-methylmorpholine-4-carbonyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-[2-(hydroxymethyl)-6-methylmorpholine-4-carbonyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 102932297 |
| Molecular Formula | C14H21NO5 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 6-[2-(hydroxymethyl)-6-methylmorpholine-4-carbonyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | CC1CN(C(=O)C2CC=CCC2C(=O)O)CC(CO)O1 |
| InChI | InChI=1S/C14H21NO5/c1-9-6-15(7-10(8-16)20-9)13(17)11-4-2-3-5-12(11)14(18)19/h2-3,9-12,16H,4-8H2,1H3,(H,18,19) |
| InChIKey | YYYCLXWPRIHSAT-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|