C11H22N2O2S — CID 102932375
N-butyl-2-(hydroxymethyl)-6-methylmorpholine-4-carbothioamide (PubChem CID 102932375) has the molecular formula C11H22N2O2S and a molecular weight of 246.38 g/mol. Its IUPAC name is N-butyl-2-(hydroxymethyl)-6-methylmorpholine-4-carbothioamide.
| Compound Name | N-butyl-2-(hydroxymethyl)-6-methylmorpholine-4-carbothioamide |
|---|---|
| PubChem CID | 102932375 |
| Molecular Formula | C11H22N2O2S |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | N-butyl-2-(hydroxymethyl)-6-methylmorpholine-4-carbothioamide |
| SMILES | CCCCNC(=S)N1CC(C)OC(CO)C1 |
| InChI | InChI=1S/C11H22N2O2S/c1-3-4-5-12-11(16)13-6-9(2)15-10(7-13)8-14/h9-10,14H,3-8H2,1-2H3,(H,12,16) |
| InChIKey | GECAZUHJOXUKCE-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|