C11H22N2O3 — CID 102932658
3-amino-1-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]pentan-1-one (PubChem CID 102932658) has the molecular formula C11H22N2O3 and a molecular weight of 230.31 g/mol. Its IUPAC name is 3-amino-1-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]pentan-1-one.
| Compound Name | 3-amino-1-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]pentan-1-one |
|---|---|
| PubChem CID | 102932658 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | 3-amino-1-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]pentan-1-one |
| SMILES | CCC(N)CC(=O)N1CC(C)OC(CO)C1 |
| InChI | InChI=1S/C11H22N2O3/c1-3-9(12)4-11(15)13-5-8(2)16-10(6-13)7-14/h8-10,14H,3-7,12H2,1-2H3 |
| InChIKey | OMCDVJSRNAFTAR-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |