C13H15BrFNO3 — CID 102932978
(2-bromo-3-fluorophenyl)-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]methanone (PubChem CID 102932978) has the molecular formula C13H15BrFNO3 and a molecular weight of 332.17 g/mol. Its IUPAC name is (2-bromo-3-fluorophenyl)-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]methanone.
| Compound Name | (2-bromo-3-fluorophenyl)-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 102932978 |
| Molecular Formula | C13H15BrFNO3 |
| Molecular Weight | 332.17 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | (2-bromo-3-fluorophenyl)-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]methanone |
| SMILES | CC1CN(C(=O)c2cccc(F)c2Br)CC(CO)O1 |
| InChI | InChI=1S/C13H15BrFNO3/c1-8-5-16(6-9(7-17)19-8)13(18)10-3-2-4-11(15)12(10)14/h2-4,8-9,17H,5-7H2,1H3 |
| InChIKey | DRQQHOCEJHASGI-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.17 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |