C17H26N2O2 — CID 102933693
[4-[4-[(cyclopropylamino)methyl]-2-methylphenyl]-6-methylmorpholin-2-yl]methanol (PubChem CID 102933693) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is [4-[4-[(cyclopropylamino)methyl]-2-methylphenyl]-6-methylmorpholin-2-yl]methanol.
| Compound Name | [4-[4-[(cyclopropylamino)methyl]-2-methylphenyl]-6-methylmorpholin-2-yl]methanol |
|---|---|
| PubChem CID | 102933693 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | [4-[4-[(cyclopropylamino)methyl]-2-methylphenyl]-6-methylmorpholin-2-yl]methanol |
| SMILES | Cc1cc(CNC2CC2)ccc1N1CC(C)OC(CO)C1 |
| InChI | InChI=1S/C17H26N2O2/c1-12-7-14(8-18-15-4-5-15)3-6-17(12)19-9-13(2)21-16(10-19)11-20/h3,6-7,13,15-16,18,20H,4-5,8-11H2,1-2H3 |
| InChIKey | ASSOHHGXTVZBPC-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|