C11H16N4O5 — CID 102934181
1-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]-2-(4-nitropyrazol-1-yl)ethanone (PubChem CID 102934181) has the molecular formula C11H16N4O5 and a molecular weight of 284.27 g/mol. Its IUPAC name is 1-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]-2-(4-nitropyrazol-1-yl)ethanone.
| Compound Name | 1-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]-2-(4-nitropyrazol-1-yl)ethanone |
|---|---|
| PubChem CID | 102934181 |
| Molecular Formula | C11H16N4O5 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 1-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]-2-(4-nitropyrazol-1-yl)ethanone |
| SMILES | CC1CN(C(=O)Cn2cc([N+](=O)[O-])cn2)CC(CO)O1 |
| InChI | InChI=1S/C11H16N4O5/c1-8-3-13(5-10(7-16)20-8)11(17)6-14-4-9(2-12-14)15(18)19/h2,4,8,10,16H,3,5-7H2,1H3 |
| InChIKey | GRDCXSNMPCZQCL-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 110.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|