C14H22F3NO3 — CID 102934496
[2-(hydroxymethyl)-6-methylmorpholin-4-yl]-[4-(trifluoromethyl)cyclohexyl]methanone (PubChem CID 102934496) has the molecular formula C14H22F3NO3 and a molecular weight of 309.33 g/mol. Its IUPAC name is [2-(hydroxymethyl)-6-methylmorpholin-4-yl]-[4-(trifluoromethyl)cyclohexyl]methanone.
| Compound Name | [2-(hydroxymethyl)-6-methylmorpholin-4-yl]-[4-(trifluoromethyl)cyclohexyl]methanone |
|---|---|
| PubChem CID | 102934496 |
| Molecular Formula | C14H22F3NO3 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | [2-(hydroxymethyl)-6-methylmorpholin-4-yl]-[4-(trifluoromethyl)cyclohexyl]methanone |
| SMILES | CC1CN(C(=O)C2CCC(C(F)(F)F)CC2)CC(CO)O1 |
| InChI | InChI=1S/C14H22F3NO3/c1-9-6-18(7-12(8-19)21-9)13(20)10-2-4-11(5-3-10)14(15,16)17/h9-12,19H,2-8H2,1H3 |
| InChIKey | HYSKWFBNRRDIMZ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |