C18H17ClFNOS — CID 10293499
(3S)-3-[(3-chloro-4-fluoro-1-benzothiophen-7-yl)oxy]-N-methyl-3-phenylpropan-1-amine (PubChem CID 10293499) has the molecular formula C18H17ClFNOS and a molecular weight of 349.86 g/mol. Its IUPAC name is (3S)-3-[(3-chloro-4-fluoro-1-benzothiophen-7-yl)oxy]-N-methyl-3-phenylpropan-1-amine.
| Compound Name | (3S)-3-[(3-chloro-4-fluoro-1-benzothiophen-7-yl)oxy]-N-methyl-3-phenylpropan-1-amine |
|---|---|
| PubChem CID | 10293499 |
| Molecular Formula | C18H17ClFNOS |
| Molecular Weight | 349.86 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | (3S)-3-[(3-chloro-4-fluoro-1-benzothiophen-7-yl)oxy]-N-methyl-3-phenylpropan-1-amine |
| SMILES | CNCC[C@H](Oc1ccc(F)c2c(Cl)csc12)c1ccccc1 |
| InChI | InChI=1S/C18H17ClFNOS/c1-21-10-9-15(12-5-3-2-4-6-12)22-16-8-7-14(20)17-13(19)11-23-18(16)17/h2-8,11,15,21H,9-10H2,1H3/t15-/m0/s1 |
| InChIKey | FHSIRHCPDSRGCZ-HNNXBMFYSA-N |
| XLogP | 5.42 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.86 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |