About [6-methyl-4-(3,3,3-trifluoropropyl)morpholin-2-yl]methanol
[6-methyl-4-(3,3,3-trifluoropropyl)morpholin-2-yl]methanol (PubChem CID 102935503) has the molecular formula C9H16F3NO2
and a molecular weight of 227.23 g/mol. Its IUPAC name is [6-methyl-4-(3,3,3-trifluoropropyl)morpholin-2-yl]methanol.
Molecular Properties
| Compound Name | [6-methyl-4-(3,3,3-trifluoropropyl)morpholin-2-yl]methanol |
| PubChem CID | 102935503 |
| Molecular Formula | C9H16F3NO2 |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | [6-methyl-4-(3,3,3-trifluoropropyl)morpholin-2-yl]methanol |
| SMILES | CC1CN(CCC(F)(F)F)CC(CO)O1 |
| InChI | InChI=1S/C9H16F3NO2/c1-7-4-13(3-2-9(10,11)12)5-8(6-14)15-7/h7-8,14H,2-6H2,1H3 |
| InChIKey | KFUGTJWNDMJVRZ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [6-methyl-4-(3,3,3-trifluoropropyl)morpholin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-methyl-4-(3,3,3-trifluoropropyl)morpholin-2-yl]methanol?
The IUPAC name of [6-methyl-4-(3,3,3-trifluoropropyl)morpholin-2-yl]methanol (CID 102935503) is [6-methyl-4-(3,3,3-trifluoropropyl)morpholin-2-yl]methanol.
What is the SMILES notation for [6-methyl-4-(3,3,3-trifluoropropyl)morpholin-2-yl]methanol?
The canonical SMILES for [6-methyl-4-(3,3,3-trifluoropropyl)morpholin-2-yl]methanol is CC1CN(CCC(F)(F)F)CC(CO)O1.
What is the InChIKey of [6-methyl-4-(3,3,3-trifluoropropyl)morpholin-2-yl]methanol?
The InChIKey is KFUGTJWNDMJVRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F3NO2/c1-7-4-13(3-2-9(10,11)12)5-8(6-14)15-7/h7-8,14H,2-6H2,1H3.
What are the key properties of [6-methyl-4-(3,3,3-trifluoropropyl)morpholin-2-yl]methanol?
[6-methyl-4-(3,3,3-trifluoropropyl)morpholin-2-yl]methanol has a molecular weight of 227.23 g/mol, XLogP of 1.02, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [6-methyl-4-(3,3,3-trifluoropropyl)morpholin-2-yl]methanol is sourced from PubChem (CID 102935503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).