C12H14BrF2O3PS — CID 10293559
[[2-bromo-4-(cyclopropylmethylsulfanylmethyl)phenyl]-difluoromethyl]phosphonic acid (PubChem CID 10293559) has the molecular formula C12H14BrF2O3PS and a molecular weight of 387.18 g/mol. Its IUPAC name is [[2-bromo-4-(cyclopropylmethylsulfanylmethyl)phenyl]-difluoromethyl]phosphonic acid.
| Compound Name | [[2-bromo-4-(cyclopropylmethylsulfanylmethyl)phenyl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 10293559 |
| Molecular Formula | C12H14BrF2O3PS |
| Molecular Weight | 387.18 g/mol |
| Exact Mass | 385.96 |
| IUPAC Name | [[2-bromo-4-(cyclopropylmethylsulfanylmethyl)phenyl]-difluoromethyl]phosphonic acid |
| SMILES | O=P(O)(O)C(F)(F)c1ccc(CSCC2CC2)cc1Br |
| InChI | InChI=1S/C12H14BrF2O3PS/c13-11-5-9(7-20-6-8-1-2-8)3-4-10(11)12(14,15)19(16,17)18/h3-5,8H,1-2,6-7H2,(H2,16,17,18) |
| InChIKey | OKICPVLAJSFUIT-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.18 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|