C23H23FN4O — CID 10293771
N-butyl-4-[2-(4-fluorophenyl)-7-methoxypyrazolo[1,5-a]pyridin-3-yl]pyridin-2-amine (PubChem CID 10293771) has the molecular formula C23H23FN4O and a molecular weight of 390.46 g/mol. Its IUPAC name is N-butyl-4-[2-(4-fluorophenyl)-7-methoxypyrazolo[1,5-a]pyridin-3-yl]pyridin-2-amine.
| Compound Name | N-butyl-4-[2-(4-fluorophenyl)-7-methoxypyrazolo[1,5-a]pyridin-3-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 10293771 |
| Molecular Formula | C23H23FN4O |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | N-butyl-4-[2-(4-fluorophenyl)-7-methoxypyrazolo[1,5-a]pyridin-3-yl]pyridin-2-amine |
| SMILES | CCCCNc1cc(-c2c(-c3ccc(F)cc3)nn3c(OC)cccc23)ccn1 |
| InChI | InChI=1S/C23H23FN4O/c1-3-4-13-25-20-15-17(12-14-26-20)22-19-6-5-7-21(29-2)28(19)27-23(22)16-8-10-18(24)11-9-16/h5-12,14-15H,3-4,13H2,1-2H3,(H,25,26) |
| InChIKey | FSWUERNXFMGBLY-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|