C14H15BrF3NO2 — CID 102937724
[2-(bromomethyl)-6-methylmorpholin-4-yl]-[2-(trifluoromethyl)phenyl]methanone (PubChem CID 102937724) has the molecular formula C14H15BrF3NO2 and a molecular weight of 366.18 g/mol. Its IUPAC name is [2-(bromomethyl)-6-methylmorpholin-4-yl]-[2-(trifluoromethyl)phenyl]methanone.
| Compound Name | [2-(bromomethyl)-6-methylmorpholin-4-yl]-[2-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 102937724 |
| Molecular Formula | C14H15BrF3NO2 |
| Molecular Weight | 366.18 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | [2-(bromomethyl)-6-methylmorpholin-4-yl]-[2-(trifluoromethyl)phenyl]methanone |
| SMILES | CC1CN(C(=O)c2ccccc2C(F)(F)F)CC(CBr)O1 |
| InChI | InChI=1S/C14H15BrF3NO2/c1-9-7-19(8-10(6-15)21-9)13(20)11-4-2-3-5-12(11)14(16,17)18/h2-5,9-10H,6-8H2,1H3 |
| InChIKey | UVKBSQQQBGRDGR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.18 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|