C13H14BrCl2NO2 — CID 102937906
[2-(bromomethyl)-6-methylmorpholin-4-yl]-(3,4-dichlorophenyl)methanone (PubChem CID 102937906) has the molecular formula C13H14BrCl2NO2 and a molecular weight of 367.07 g/mol. Its IUPAC name is [2-(bromomethyl)-6-methylmorpholin-4-yl]-(3,4-dichlorophenyl)methanone.
| Compound Name | [2-(bromomethyl)-6-methylmorpholin-4-yl]-(3,4-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 102937906 |
| Molecular Formula | C13H14BrCl2NO2 |
| Molecular Weight | 367.07 g/mol |
| Exact Mass | 364.96 |
| IUPAC Name | [2-(bromomethyl)-6-methylmorpholin-4-yl]-(3,4-dichlorophenyl)methanone |
| SMILES | CC1CN(C(=O)c2ccc(Cl)c(Cl)c2)CC(CBr)O1 |
| InChI | InChI=1S/C13H14BrCl2NO2/c1-8-6-17(7-10(5-14)19-8)13(18)9-2-3-11(15)12(16)4-9/h2-4,8,10H,5-7H2,1H3 |
| InChIKey | RZDPVFQVYYWQSA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.07 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|